C28H46N2O7 — CID 70031758
[(2R,3S,4S,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (Z)-octadec-9-enoate (PubChem CID 70031758) has the molecular formula C28H46N2O7 and a molecular weight of 522.68 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [(2R,3S,4S,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 70031758 |
| Molecular Formula | C28H46N2O7 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H46N2O7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(31)36-20-22-24(32)25(33)27(37-22)30-19-21(2)26(34)29-28(30)35/h10-11,19,22,24-25,27,32-33H,3-9,12-18,20H2,1-2H3,(H,29,34,35)/b11-10-/t22-,24-,25+,27-/m1/s1 |
| InChIKey | VGFVCMJHUMGVSN-MFOADFBQSA-N |
| XLogP | 4.04 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|