C14H22N2O6 — CID 88880674
1-[(2R,3R,4R,5R)-5-[(1S)-1-deuterioethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 88880674) has the molecular formula C14H22N2O6 and a molecular weight of 315.34 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[(1S)-1-deuterioethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[(1S)-1-deuterioethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88880674 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[(1S)-1-deuterioethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | [2H][C@@H](C)[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OCCOC)[C@@H]1O |
| InChI | InChI=1S/C14H22N2O6/c1-4-9-10(17)11(21-6-5-20-3)13(22-9)16-7-8(2)12(18)15-14(16)19/h7,9-11,13,17H,4-6H2,1-3H3,(H,15,18,19)/t9-,10-,11-,13-/m1/s1/i4D/t4-,9+,10+,11+,13+/m0 |
| InChIKey | CINZYPWFRVKZGV-BEUYSFJYSA-N |
| XLogP | -0.46 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|