C17H28N2O6 — CID 171403801
1-[(2R,4S,5S)-4-tert-butyl-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 171403801) has the molecular formula C17H28N2O6 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-tert-butyl-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-tert-butyl-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171403801 |
| Molecular Formula | C17H28N2O6 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-[(2R,4S,5S)-4-tert-butyl-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COCCOC1[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@H](CO)[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C17H28N2O6/c1-10-8-19(16(22)18-14(10)21)15-13(24-7-6-23-5)12(17(2,3)4)11(9-20)25-15/h8,11-13,15,20H,6-7,9H2,1-5H3,(H,18,21,22)/t11-,12+,13?,15-/m1/s1 |
| InChIKey | CGRUFTDYYAXCKU-RLCAUIQDSA-N |
| XLogP | 0.43 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|