C18H26N2O9 — CID 167597041
4-[(2R,3S,5R)-2-ethyl-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-4-oxobutanoic acid (PubChem CID 167597041) has the molecular formula C18H26N2O9 and a molecular weight of 414.41 g/mol. Its IUPAC name is 4-[(2R,3S,5R)-2-ethyl-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[(2R,3S,5R)-2-ethyl-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 167597041 |
| Molecular Formula | C18H26N2O9 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-[(2R,3S,5R)-2-ethyl-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-4-oxobutanoic acid |
| SMILES | CC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C(OCCOC)[C@H]1OC(=O)CCC(=O)O |
| InChI | InChI=1S/C18H26N2O9/c1-4-11-14(29-13(23)6-5-12(21)22)15(27-8-7-26-3)17(28-11)20-9-10(2)16(24)19-18(20)25/h9,11,14-15,17H,4-8H2,1-3H3,(H,21,22)(H,19,24,25)/t11-,14+,15?,17-/m1/s1 |
| InChIKey | OBHGCISGQLDUKK-XHUFTMDJSA-N |
| XLogP | -0.04 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|