C15H25N2O8PS — CID 88941491
1-[(2R,5R)-5-ethyl-4-[hydroxy(methoxy)phosphinothioyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 88941491) has the molecular formula C15H25N2O8PS and a molecular weight of 424.41 g/mol. Its IUPAC name is 1-[(2R,5R)-5-ethyl-4-[hydroxy(methoxy)phosphinothioyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-ethyl-4-[hydroxy(methoxy)phosphinothioyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88941491 |
| Molecular Formula | C15H25N2O8PS |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1-[(2R,5R)-5-ethyl-4-[hydroxy(methoxy)phosphinothioyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C(OCCOC)C1OP(O)(=S)OC |
| InChI | InChI=1S/C15H25N2O8PS/c1-5-10-11(25-26(20,27)22-4)12(23-7-6-21-3)14(24-10)17-8-9(2)13(18)16-15(17)19/h8,10-12,14H,5-7H2,1-4H3,(H,20,27)(H,16,18,19)/t10-,11?,12?,14-,26?/m1/s1 |
| InChIKey | NQRNIGXDGDKHJW-JNRTZXJJSA-N |
| XLogP | 0.43 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|