C16H28N2O6 — CID 170577941
ethane;1-[5-(hydroxymethyl)-3-(2-methoxyethoxy)-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 170577941) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is ethane;1-[5-(hydroxymethyl)-3-(2-methoxyethoxy)-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | ethane;1-[5-(hydroxymethyl)-3-(2-methoxyethoxy)-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170577941 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | ethane;1-[5-(hydroxymethyl)-3-(2-methoxyethoxy)-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC.COCCOC1C(C)C(CO)OC1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H22N2O6.C2H6/c1-8-6-16(14(19)15-12(8)18)13-11(21-5-4-20-3)9(2)10(7-17)22-13;1-2/h6,9-11,13,17H,4-5,7H2,1-3H3,(H,15,18,19);1-2H3 |
| InChIKey | LIYCJQBEXAPUKI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|