C17H26N2O8 — CID 123783861
1-[3-hydroxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propan-2-yl acetate (PubChem CID 123783861) has the molecular formula C17H26N2O8 and a molecular weight of 386.40 g/mol. Its IUPAC name is 1-[3-hydroxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propan-2-yl acetate.
| Compound Name | 1-[3-hydroxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propan-2-yl acetate |
|---|---|
| PubChem CID | 123783861 |
| Molecular Formula | C17H26N2O8 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[3-hydroxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propan-2-yl acetate |
| SMILES | COCCOC1C(O)C(CC(C)OC(C)=O)OC1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H26N2O8/c1-9-8-19(17(23)18-15(9)22)16-14(25-6-5-24-4)13(21)12(27-16)7-10(2)26-11(3)20/h8,10,12-14,16,21H,5-7H2,1-4H3,(H,18,22,23) |
| InChIKey | UPTPYBLKSRZQJI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|