C20H23IN2O7 — CID 173466834
[(3S,4R)-2-(iodomethyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate (PubChem CID 173466834) has the molecular formula C20H23IN2O7 and a molecular weight of 530.32 g/mol. Its IUPAC name is [(3S,4R)-2-(iodomethyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate.
| Compound Name | [(3S,4R)-2-(iodomethyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 173466834 |
| Molecular Formula | C20H23IN2O7 |
| Molecular Weight | 530.32 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | [(3S,4R)-2-(iodomethyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
| SMILES | COCCO[C@H]1C(n2cc(C)c(=O)[nH]c2=O)OC(CI)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23IN2O7/c1-12-11-23(20(26)22-17(12)24)18-16(28-9-8-27-2)15(14(10-21)29-18)30-19(25)13-6-4-3-5-7-13/h3-7,11,14-16,18H,8-10H2,1-2H3,(H,22,24,26)/t14?,15-,16-,18?/m1/s1 |
| InChIKey | RHGMMASDKWMUNQ-GARNVTTQSA-N |
| XLogP | 1.43 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|