C27H39N2O11P — CID 122683331
[(2R,3R,4R,5R)-2-[(1R,2R)-2-[diethoxy(ethylidene)-λ5-phosphanyl]-1,2-dihydroxyethyl]-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate (PubChem CID 122683331) has the molecular formula C27H39N2O11P and a molecular weight of 598.59 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[(1R,2R)-2-[diethoxy(ethylidene)-λ5-phosphanyl]-1,2-dihydroxyethyl]-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-2-[(1R,2R)-2-[diethoxy(ethylidene)-λ5-phosphanyl]-1,2-dihydroxyethyl]-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 122683331 |
| Molecular Formula | C27H39N2O11P |
| Molecular Weight | 598.59 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[(1R,2R)-2-[diethoxy(ethylidene)-λ5-phosphanyl]-1,2-dihydroxyethyl]-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
| SMILES | CC=P(OCC)(OCC)[C@@H](O)[C@H](O)[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OCCOC)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H39N2O11P/c1-6-37-41(8-3,38-7-2)26(33)19(30)20-21(40-25(32)18-12-10-9-11-13-18)22(36-15-14-35-5)24(39-20)29-16-17(4)23(31)28-27(29)34/h8-13,16,19-22,24,26,30,33H,6-7,14-15H2,1-5H3,(H,28,31,34)/t19-,20-,21-,22-,24-,26-/m1/s1 |
| InChIKey | LKBWDTZWBRWRHU-ZLQOAXGPSA-N |
| XLogP | 1.42 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.59 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|