C21H25N3O8 — CID 130346889
[(1R)-1-[(2S,3R,4R,5R)-3-hydroxy-4-[2-(methylamino)-2-oxoethoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethyl] benzoate (PubChem CID 130346889) has the molecular formula C21H25N3O8 and a molecular weight of 447.44 g/mol. Its IUPAC name is [(1R)-1-[(2S,3R,4R,5R)-3-hydroxy-4-[2-(methylamino)-2-oxoethoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethyl] benzoate.
| Compound Name | [(1R)-1-[(2S,3R,4R,5R)-3-hydroxy-4-[2-(methylamino)-2-oxoethoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethyl] benzoate |
|---|---|
| PubChem CID | 130346889 |
| Molecular Formula | C21H25N3O8 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [(1R)-1-[(2S,3R,4R,5R)-3-hydroxy-4-[2-(methylamino)-2-oxoethoxy]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethyl] benzoate |
| SMILES | CNC(=O)CO[C@@H]1[C@H](O)[C@@H]([C@@H](C)OC(=O)c2ccccc2)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H25N3O8/c1-11-9-24(21(29)23-18(11)27)19-17(30-10-14(25)22-3)15(26)16(32-19)12(2)31-20(28)13-7-5-4-6-8-13/h4-9,12,15-17,19,26H,10H2,1-3H3,(H,22,25)(H,23,27,29)/t12-,15-,16-,17-,19-/m1/s1 |
| InChIKey | RHMHQQHVLMNEQV-QLXPXKAKSA-N |
| XLogP | -0.52 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |