C17H18N2O7 — CID 67641068
1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 67641068) has the molecular formula C17H18N2O7 and a molecular weight of 362.34 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67641068 |
| Molecular Formula | C17H18N2O7 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](C(O)C(=O)c3ccccc3)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N2O7/c1-8-7-19(17(25)18-15(8)24)16-13(23)12(22)14(26-16)11(21)10(20)9-5-3-2-4-6-9/h2-7,11-14,16,21-23H,1H3,(H,18,24,25)/t11?,12-,13+,14+,16+/m0/s1 |
| InChIKey | NEDNERFKAAQDPO-DFKKCSDESA-N |
| XLogP | -1.29 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |