C18H16N2O6 — CID 18634666
5-ethynyl-1-[(2R,4S,5S)-4-hydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 18634666) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is 5-ethynyl-1-[(2R,4S,5S)-4-hydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-ethynyl-1-[(2R,4S,5S)-4-hydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18634666 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 5-ethynyl-1-[(2R,4S,5S)-4-hydroxy-5-(1-hydroxy-2-oxo-2-phenylethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#Cc1cn([C@H]2C[C@H](O)[C@@H](C(O)C(=O)c3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H16N2O6/c1-2-10-9-20(18(25)19-17(10)24)13-8-12(21)16(26-13)15(23)14(22)11-6-4-3-5-7-11/h1,3-7,9,12-13,15-16,21,23H,8H2,(H,19,24,25)/t12-,13+,15?,16-/m0/s1 |
| InChIKey | CXEHJVWAHWEGNU-AMFJVREVSA-N |
| XLogP | -0.59 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|