C42H36N2O7 — CID 102403844
1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-5-(2-naphthalen-1-ylethynyl)pyrimidine-2,4-dione (PubChem CID 102403844) has the molecular formula C42H36N2O7 and a molecular weight of 680.76 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-5-(2-naphthalen-1-ylethynyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-5-(2-naphthalen-1-ylethynyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102403844 |
| Molecular Formula | C42H36N2O7 |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.25 |
| IUPAC Name | 1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-5-(2-naphthalen-1-ylethynyl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)C(O)[C@H]2O[C@@H](n3cc(C#Cc4cccc5ccccc45)c(=O)[nH]c3=O)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C42H36N2O7/c1-49-33-21-17-31(18-22-33)42(30-12-4-3-5-13-30,32-19-23-34(50-2)24-20-32)39(46)38-36(45)25-37(51-38)44-26-29(40(47)43-41(44)48)16-15-28-11-8-10-27-9-6-7-14-35(27)28/h3-14,17-24,26,36-39,45-46H,25H2,1-2H3,(H,43,47,48)/t36-,37+,38-,39?/m0/s1 |
| InChIKey | ZKYIPYDIKNISLI-QGIVUMGRSA-N |
| XLogP | 5.15 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|