C32H32N2O6 — CID 67729538
1-[(2R,5S)-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]-4-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 67729538) has the molecular formula C32H32N2O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]-4-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]-4-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67729538 |
| Molecular Formula | C32H32N2O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 1-[(2R,5S)-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]-4-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=C1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1C(O)C(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H32N2O6/c1-20-18-27(34-19-21(2)30(36)33-31(34)37)40-28(20)29(35)32(22-8-6-5-7-9-22,23-10-14-25(38-3)15-11-23)24-12-16-26(39-4)17-13-24/h5-17,19,27-29,35H,1,18H2,2-4H3,(H,33,36,37)/t27-,28+,29?/m1/s1 |
| InChIKey | GLUGRHHYCSWSKV-PEIRWHMSSA-N |
| XLogP | 4.10 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|