C31H33N3O4 — CID 158702146
1-[(2R,4R,5R)-4-amino-5-[3-(4-methoxyphenyl)-3,3-diphenylpropyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 158702146) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-4-amino-5-[3-(4-methoxyphenyl)-3,3-diphenylpropyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-4-amino-5-[3-(4-methoxyphenyl)-3,3-diphenylpropyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 158702146 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 1-[(2R,4R,5R)-4-amino-5-[3-(4-methoxyphenyl)-3,3-diphenylpropyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(CC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@H]2N)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H33N3O4/c1-21-20-34(30(36)33-29(21)35)28-19-26(32)27(38-28)17-18-31(22-9-5-3-6-10-22,23-11-7-4-8-12-23)24-13-15-25(37-2)16-14-24/h3-16,20,26-28H,17-19,32H2,1-2H3,(H,33,35,36)/t26-,27-,28-/m1/s1 |
| InChIKey | USHXKFZJGRLGKI-JCYYIGJDSA-N |
| XLogP | 4.28 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|