C31H31F2N2O8P — CID 10031919
1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(difluorophosphoryloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10031919) has the molecular formula C31H31F2N2O8P and a molecular weight of 628.57 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(difluorophosphoryloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(difluorophosphoryloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10031919 |
| Molecular Formula | C31H31F2N2O8P |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(difluorophosphoryloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(O[C@H]2C[C@H](n3cc(C)c(=O)[nH]c3=O)O[C@@H]2COP(=O)(F)F)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H31F2N2O8P/c1-20-18-35(30(37)34-29(20)36)28-17-26(27(42-28)19-41-44(32,33)38)43-31(21-7-5-4-6-8-21,22-9-13-24(39-2)14-10-22)23-11-15-25(40-3)16-12-23/h4-16,18,26-28H,17,19H2,1-3H3,(H,34,36,37)/t26-,27+,28+/m0/s1 |
| InChIKey | XGVZIDPROWONBR-UPRLRBBYSA-N |
| XLogP | 5.59 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|