C30H33AsN3O6P — CID 173215795
[(2S,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethyl]arsanylmethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphonamidous acid (PubChem CID 173215795) has the molecular formula C30H33AsN3O6P and a molecular weight of 637.51 g/mol. Its IUPAC name is [(2S,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethyl]arsanylmethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphonamidous acid.
| Compound Name | [(2S,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethyl]arsanylmethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphonamidous acid |
|---|---|
| PubChem CID | 173215795 |
| Molecular Formula | C30H33AsN3O6P |
| Molecular Weight | 637.51 g/mol |
| Exact Mass | 637.13 |
| IUPAC Name | [(2S,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethyl]arsanylmethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphonamidous acid |
| SMILES | COc1ccc(C([AsH]C[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP(N)O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H33AsN3O6P/c1-20-19-34(29(36)33-28(20)35)27-17-25(40-41(32)37)26(39-27)18-31-30(21-9-5-3-6-10-21,22-11-7-4-8-12-22)23-13-15-24(38-2)16-14-23/h3-16,19,25-27,31,37H,17-18,32H2,1-2H3,(H,33,35,36)/t25-,26+,27+,41?/m0/s1 |
| InChIKey | ZVZQTLFONKVNSG-UDWGBEOPSA-N |
| XLogP | 3.55 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|