C33H34N2O7 — CID 70153151
1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione (PubChem CID 70153151) has the molecular formula C33H34N2O7 and a molecular weight of 570.64 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70153151 |
| Molecular Formula | C33H34N2O7 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCc1cn([C@H]2C[C@H](O)[C@@H](C(O)C(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H34N2O7/c1-4-8-21-20-35(32(39)34-31(21)38)28-19-27(36)29(42-28)30(37)33(22-9-6-5-7-10-22,23-11-15-25(40-2)16-12-23)24-13-17-26(41-3)18-14-24/h4-7,9-18,20,27-30,36-37H,1,8,19H2,2-3H3,(H,34,38,39)/t27-,28+,29-,30?/m0/s1 |
| InChIKey | HBAOQOWMZYBHBL-AFPMMHFWSA-N |
| XLogP | 3.33 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|