C32H31BrN2O7 — CID 68506881
1-[(2R,4S,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]prop-2-enyl]-4-hydroxyoxolan-2-yl]-5-bromopyrimidine-2,4-dione (PubChem CID 68506881) has the molecular formula C32H31BrN2O7 and a molecular weight of 635.51 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]prop-2-enyl]-4-hydroxyoxolan-2-yl]-5-bromopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]prop-2-enyl]-4-hydroxyoxolan-2-yl]-5-bromopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 68506881 |
| Molecular Formula | C32H31BrN2O7 |
| Molecular Weight | 635.51 g/mol |
| Exact Mass | 634.13 |
| IUPAC Name | 1-[(2R,4S,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]prop-2-enyl]-4-hydroxyoxolan-2-yl]-5-bromopyrimidine-2,4-dione |
| SMILES | C=CC(OC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)[C@H]1O[C@@H](n2cc(Br)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C32H31BrN2O7/c1-4-27(29-26(36)18-28(41-29)35-19-25(33)30(37)34-31(35)38)42-32(20-8-6-5-7-9-20,21-10-14-23(39-2)15-11-21)22-12-16-24(40-3)17-13-22/h4-17,19,26-29,36H,1,18H2,2-3H3,(H,34,37,38)/t26-,27?,28+,29-/m0/s1 |
| InChIKey | IJINSUOVSUFPSX-ZNBPAQNLSA-N |
| XLogP | 4.53 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|