C32H35N3O7 — CID 57332429
1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(dimethylamino)pyrimidine-2,4-dione (PubChem CID 57332429) has the molecular formula C32H35N3O7 and a molecular weight of 573.65 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(dimethylamino)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(dimethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57332429 |
| Molecular Formula | C32H35N3O7 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(dimethylamino)pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(N(C)C)c(=O)[nH]c3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H35N3O7/c1-34(2)26-19-35(31(38)33-30(26)37)29-18-27(36)28(42-29)20-41-32(21-8-6-5-7-9-21,22-10-14-24(39-3)15-11-22)23-12-16-25(40-4)17-13-23/h5-17,19,27-29,36H,18,20H2,1-4H3,(H,33,37,38)/t27-,28+,29+/m0/s1 |
| InChIKey | PLGJYJLSVGTTDN-ZGIBFIJWSA-N |
| XLogP | 3.28 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|