C38H35N5O6 — CID 20778049
5-(1-benzyltriazol-4-yl)-1-[(2R,4S,5R)-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 20778049) has the molecular formula C38H35N5O6 and a molecular weight of 657.73 g/mol. Its IUPAC name is 5-(1-benzyltriazol-4-yl)-1-[(2R,4S,5R)-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(1-benzyltriazol-4-yl)-1-[(2R,4S,5R)-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20778049 |
| Molecular Formula | C38H35N5O6 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | 5-(1-benzyltriazol-4-yl)-1-[(2R,4S,5R)-4-hydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(-c4cn(Cc5ccccc5)nn4)c(=O)[nH]c3=O)C[C@@H]2O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H35N5O6/c1-47-30-19-17-29(18-20-30)38(27-13-7-3-8-14-27,28-15-9-4-10-16-28)48-25-34-33(44)21-35(49-34)43-23-31(36(45)39-37(43)46)32-24-42(41-40-32)22-26-11-5-2-6-12-26/h2-20,23-24,33-35,44H,21-22,25H2,1H3,(H,39,45,46)/t33-,34+,35+/m0/s1 |
| InChIKey | KVDGKWPOWKJAFF-BMPTZRATSA-N |
| XLogP | 4.51 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|