C44H36N2O9 — CID 25228274
1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(9,10-dioxoanthracen-2-yl)pyrimidine-2,4-dione (PubChem CID 25228274) has the molecular formula C44H36N2O9 and a molecular weight of 736.78 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(9,10-dioxoanthracen-2-yl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(9,10-dioxoanthracen-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25228274 |
| Molecular Formula | C44H36N2O9 |
| Molecular Weight | 736.78 g/mol |
| Exact Mass | 736.24 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-(9,10-dioxoanthracen-2-yl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(-c4ccc5c(c4)C(=O)c4ccccc4C5=O)c(=O)[nH]c3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C44H36N2O9/c1-52-30-17-13-28(14-18-30)44(27-8-4-3-5-9-27,29-15-19-31(53-2)20-16-29)54-25-38-37(47)23-39(55-38)46-24-36(42(50)45-43(46)51)26-12-21-34-35(22-26)41(49)33-11-7-6-10-32(33)40(34)48/h3-22,24,37-39,47H,23,25H2,1-2H3,(H,45,50,51)/t37-,38+,39+/m0/s1 |
| InChIKey | XNRMOLCQRYKPSY-LCKTVPPXSA-N |
| XLogP | 5.65 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.78 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|