C23H18N2O7 — CID 25228276
5-(9,10-dioxoanthracen-2-yl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 25228276) has the molecular formula C23H18N2O7 and a molecular weight of 434.40 g/mol. Its IUPAC name is 5-(9,10-dioxoanthracen-2-yl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(9,10-dioxoanthracen-2-yl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25228276 |
| Molecular Formula | C23H18N2O7 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 5-(9,10-dioxoanthracen-2-yl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(-c3cn([C@H]4C[C@H](O)[C@@H](CO)O4)c(=O)[nH]c3=O)ccc21 |
| InChI | InChI=1S/C23H18N2O7/c26-10-18-17(27)8-19(32-18)25-9-16(22(30)24-23(25)31)11-5-6-14-15(7-11)21(29)13-4-2-1-3-12(13)20(14)28/h1-7,9,17-19,26-27H,8,10H2,(H,24,30,31)/t17-,18+,19+/m0/s1 |
| InChIKey | MTTVPGLBCJBXBG-IPMKNSEASA-N |
| XLogP | 0.62 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|