C15H15IN2O5 — CID 10670271
1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(3-iodophenyl)pyrimidine-2,4-dione (PubChem CID 10670271) has the molecular formula C15H15IN2O5 and a molecular weight of 430.20 g/mol. Its IUPAC name is 1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(3-iodophenyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(3-iodophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10670271 |
| Molecular Formula | C15H15IN2O5 |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(3-iodophenyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2C[C@H](O)[C@@H](CO)O2)cc1-c1cccc(I)c1 |
| InChI | InChI=1S/C15H15IN2O5/c16-9-3-1-2-8(4-9)10-6-18(15(22)17-14(10)21)13-5-11(20)12(7-19)23-13/h1-4,6,11-13,19-20H,5,7H2,(H,17,21,22)/t11-,12+,13-/m0/s1 |
| InChIKey | ILNOQGRYOAHTTN-XQQFMLRXSA-N |
| XLogP | 0.45 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|