C25H20N2O5 — CID 89241147
1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-pyren-2-ylpyrimidine-2,4-dione (PubChem CID 89241147) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-pyren-2-ylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-pyren-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89241147 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-pyren-2-ylpyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2CC(O)[C@@H](CO)O2)cc1-c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C25H20N2O5/c28-12-20-19(29)10-21(32-20)27-11-18(24(30)26-25(27)31)17-8-15-6-4-13-2-1-3-14-5-7-16(9-17)23(15)22(13)14/h1-9,11,19-21,28-29H,10,12H2,(H,26,30,31)/t19?,20-,21-/m1/s1 |
| InChIKey | AHOAPXNQAUCCJG-RWLBOTFQSA-N |
| XLogP | 2.74 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|