C21H17N3O7 — CID 91144348
2-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]benzo[de]isoquinoline-1,3-dione (PubChem CID 91144348) has the molecular formula C21H17N3O7 and a molecular weight of 423.38 g/mol. Its IUPAC name is 2-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 91144348 |
| Molecular Formula | C21H17N3O7 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1c1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H17N3O7/c25-9-15-14(26)7-16(31-15)23-8-13(18(27)22-21(23)30)24-19(28)11-5-1-3-10-4-2-6-12(17(10)11)20(24)29/h1-6,8,14-16,25-26H,7,9H2,(H,22,27,30)/t14-,15+,16+/m0/s1 |
| InChIKey | PTCBZSQKWLCZPC-ARFHVFGLSA-N |
| XLogP | 0.13 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|