C35H36F3N3O8 — CID 70292556
5-(3-amino-5,5,5-trifluoro-4-oxopentyl)-1-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70292556) has the molecular formula C35H36F3N3O8 and a molecular weight of 683.68 g/mol. Its IUPAC name is 5-(3-amino-5,5,5-trifluoro-4-oxopentyl)-1-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(3-amino-5,5,5-trifluoro-4-oxopentyl)-1-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70292556 |
| Molecular Formula | C35H36F3N3O8 |
| Molecular Weight | 683.68 g/mol |
| Exact Mass | 683.25 |
| IUPAC Name | 5-(3-amino-5,5,5-trifluoro-4-oxopentyl)-1-[(2S,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@@H]2O[C@H](n3cc(CCC(N)C(=O)C(F)(F)F)c(=O)[nH]c3=O)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H36F3N3O8/c1-46-25-13-9-23(10-14-25)34(22-6-4-3-5-7-22,24-11-15-26(47-2)16-12-24)48-20-29-28(42)18-30(49-29)41-19-21(32(44)40-33(41)45)8-17-27(39)31(43)35(36,37)38/h3-7,9-16,19,27-30,42H,8,17-18,20,39H2,1-2H3,(H,40,44,45)/t27?,28?,29-,30-/m0/s1 |
| InChIKey | GJTGVPXBIOQROY-AGTZKDDFSA-N |
| XLogP | 3.60 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|