C12H14BrFN2O4 — CID 68507459
5-bromo-1-[(2R,4S,5S)-5-(1-fluoroprop-2-enyl)-4-methoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 68507459) has the molecular formula C12H14BrFN2O4 and a molecular weight of 349.16 g/mol. Its IUPAC name is 5-bromo-1-[(2R,4S,5S)-5-(1-fluoroprop-2-enyl)-4-methoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[(2R,4S,5S)-5-(1-fluoroprop-2-enyl)-4-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 68507459 |
| Molecular Formula | C12H14BrFN2O4 |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 5-bromo-1-[(2R,4S,5S)-5-(1-fluoroprop-2-enyl)-4-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CC(F)[C@H]1O[C@@H](n2cc(Br)c(=O)[nH]c2=O)C[C@@H]1OC |
| InChI | InChI=1S/C12H14BrFN2O4/c1-3-7(14)10-8(19-2)4-9(20-10)16-5-6(13)11(17)15-12(16)18/h3,5,7-10H,1,4H2,2H3,(H,15,17,18)/t7?,8-,9+,10+/m0/s1 |
| InChIKey | OJQVZHSASVVJKY-HCZOVWHVSA-N |
| XLogP | 1.13 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|