C21H30BrClN4O6 — CID 68501376
[(2S,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(1-chloroprop-2-enyl)oxolan-3-yl] (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate (PubChem CID 68501376) has the molecular formula C21H30BrClN4O6 and a molecular weight of 549.85 g/mol. Its IUPAC name is [(2S,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(1-chloroprop-2-enyl)oxolan-3-yl] (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate.
| Compound Name | [(2S,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(1-chloroprop-2-enyl)oxolan-3-yl] (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 68501376 |
| Molecular Formula | C21H30BrClN4O6 |
| Molecular Weight | 549.85 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | [(2S,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(1-chloroprop-2-enyl)oxolan-3-yl] (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate |
| SMILES | C=CC(Cl)[C@H]1O[C@@H](n2cc(Br)c(=O)[nH]c2=O)C[C@@H]1OC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)C(C)C |
| InChI | InChI=1S/C21H30BrClN4O6/c1-6-12(23)17-13(7-14(33-17)27-8-11(22)18(28)26-21(27)31)32-20(30)16(10(4)5)25-19(29)15(24)9(2)3/h6,8-10,12-17H,1,7,24H2,2-5H3,(H,25,29)(H,26,28,31)/t12?,13-,14+,15-,16-,17+/m0/s1 |
| InChIKey | WCJTWWZAISVWFO-HUESISHMSA-N |
| XLogP | 1.42 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.85 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|