C42H50N4O8 — CID 71732751
[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(3,3,3-triphenylpropanoyloxymethyl)oxolan-3-yl] (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-methylbutanoate (PubChem CID 71732751) has the molecular formula C42H50N4O8 and a molecular weight of 738.88 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(3,3,3-triphenylpropanoyloxymethyl)oxolan-3-yl] (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-methylbutanoate.
| Compound Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(3,3,3-triphenylpropanoyloxymethyl)oxolan-3-yl] (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 71732751 |
| Molecular Formula | C42H50N4O8 |
| Molecular Weight | 738.88 g/mol |
| Exact Mass | 738.36 |
| IUPAC Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(3,3,3-triphenylpropanoyloxymethyl)oxolan-3-yl] (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-methylbutanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@H](C(=O)O[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COC(=O)CC(c1ccccc1)(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C42H50N4O8/c1-6-27(4)36(43)39(49)44-37(26(2)3)40(50)54-32-22-34(46-24-28(5)38(48)45-41(46)51)53-33(32)25-52-35(47)23-42(29-16-10-7-11-17-29,30-18-12-8-13-19-30)31-20-14-9-15-21-31/h7-21,24,26-27,32-34,36-37H,6,22-23,25,43H2,1-5H3,(H,44,49)(H,45,48,51)/t27-,32-,33+,34+,36-,37-/m0/s1 |
| InChIKey | FXVLECNOFGABLK-PGONPMSFSA-N |
| XLogP | 4.53 |
| TPSA | 171.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|