C34H33Cl3N2O7 — CID 15725811
[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] (1,1,1-trichloro-2-methylpropan-2-yl) carbonate (PubChem CID 15725811) has the molecular formula C34H33Cl3N2O7 and a molecular weight of 688.00 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] (1,1,1-trichloro-2-methylpropan-2-yl) carbonate.
| Compound Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] (1,1,1-trichloro-2-methylpropan-2-yl) carbonate |
|---|---|
| PubChem CID | 15725811 |
| Molecular Formula | C34H33Cl3N2O7 |
| Molecular Weight | 688.00 g/mol |
| Exact Mass | 686.14 |
| IUPAC Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] (1,1,1-trichloro-2-methylpropan-2-yl) carbonate |
| SMILES | Cc1cn([C@H]2C[C@H](OC(=O)OC(C)(C)C(Cl)(Cl)Cl)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H33Cl3N2O7/c1-22-20-39(30(41)38-29(22)40)28-19-26(45-31(42)46-32(2,3)34(35,36)37)27(44-28)21-43-33(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,20,26-28H,19,21H2,1-3H3,(H,38,40,41)/t26-,27+,28+/m0/s1 |
| InChIKey | FOWZLUVTFVPSEP-UPRLRBBYSA-N |
| XLogP | 6.81 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.00 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|