C37H31N3O7 — CID 68836402
2-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl]oxyisoindole-1,3-dione (PubChem CID 68836402) has the molecular formula C37H31N3O7 and a molecular weight of 629.67 g/mol. Its IUPAC name is 2-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 68836402 |
| Molecular Formula | C37H31N3O7 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | 2-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl]oxyisoindole-1,3-dione |
| SMILES | Cc1cn([C@H]2C[C@H](ON3C(=O)c4ccccc4C3=O)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C37H31N3O7/c1-24-22-39(36(44)38-33(24)41)32-21-30(47-40-34(42)28-19-11-12-20-29(28)35(40)43)31(46-32)23-45-37(25-13-5-2-6-14-25,26-15-7-3-8-16-26)27-17-9-4-10-18-27/h2-20,22,30-32H,21,23H2,1H3,(H,38,41,44)/t30-,31+,32+/m0/s1 |
| InChIKey | VYPUTDOZYXLZEH-DCMFLLSESA-N |
| XLogP | 4.74 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|