C18H16IN3O6 — CID 70229760
2-[(2S,5R)-2-(iodomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyisoindole-1,3-dione (PubChem CID 70229760) has the molecular formula C18H16IN3O6 and a molecular weight of 497.25 g/mol. Its IUPAC name is 2-[(2S,5R)-2-(iodomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-[(2S,5R)-2-(iodomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 70229760 |
| Molecular Formula | C18H16IN3O6 |
| Molecular Weight | 497.25 g/mol |
| Exact Mass | 497.01 |
| IUPAC Name | 2-[(2S,5R)-2-(iodomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyisoindole-1,3-dione |
| SMILES | Cc1cn([C@H]2CC(ON3C(=O)c4ccccc4C3=O)[C@@H](CI)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H16IN3O6/c1-9-8-21(18(26)20-15(9)23)14-6-12(13(7-19)27-14)28-22-16(24)10-4-2-3-5-11(10)17(22)25/h2-5,8,12-14H,6-7H2,1H3,(H,20,23,26)/t12?,13-,14-/m1/s1 |
| InChIKey | KYNCLTQHCWRIJG-ILMHWDKJSA-N |
| XLogP | 1.16 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|