C34H40IN3O5 — CID 10009915
trimethyl-[2-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl]oxyethyl]azanium iodide (PubChem CID 10009915) has the molecular formula C34H40IN3O5 and a molecular weight of 697.61 g/mol. Its IUPAC name is trimethyl-[2-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl]oxyethyl]azanium iodide.
| Compound Name | trimethyl-[2-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl]oxyethyl]azanium iodide |
|---|---|
| PubChem CID | 10009915 |
| Molecular Formula | C34H40IN3O5 |
| Molecular Weight | 697.61 g/mol |
| Exact Mass | 697.20 |
| IUPAC Name | trimethyl-[2-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl]oxyethyl]azanium iodide |
| SMILES | Cc1cn([C@H]2C[C@H](OCC[N+](C)(C)C)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O2)c(=O)[nH]c1=O.[I-] |
| InChI | InChI=1S/C34H39N3O5.HI/c1-25-23-36(33(39)35-32(25)38)31-22-29(40-21-20-37(2,3)4)30(42-31)24-41-34(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28;/h5-19,23,29-31H,20-22,24H2,1-4H3;1H/t29-,30+,31+;/m0./s1 |
| InChIKey | UBVFOOQVYDMRHB-QLIHSIHUSA-N |
| XLogP | 1.24 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.61 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|