C11H11BrClN5O3 — CID 90774749
1-[(2R,4S,5S)-4-azido-5-(1-chloroprop-2-enyl)oxolan-2-yl]-5-bromopyrimidine-2,4-dione (PubChem CID 90774749) has the molecular formula C11H11BrClN5O3 and a molecular weight of 376.60 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-5-(1-chloroprop-2-enyl)oxolan-2-yl]-5-bromopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-azido-5-(1-chloroprop-2-enyl)oxolan-2-yl]-5-bromopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90774749 |
| Molecular Formula | C11H11BrClN5O3 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-5-(1-chloroprop-2-enyl)oxolan-2-yl]-5-bromopyrimidine-2,4-dione |
| SMILES | C=CC(Cl)[C@H]1O[C@@H](n2cc(Br)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C11H11BrClN5O3/c1-2-6(13)9-7(16-17-14)3-8(21-9)18-4-5(12)10(19)15-11(18)20/h2,4,6-9H,1,3H2,(H,15,19,20)/t6?,7-,8+,9+/m0/s1 |
| InChIKey | UKUALMUWNQEENJ-GSLILNRNSA-N |
| XLogP | 2.06 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|