C11H11BrClFN2O3 — CID 68501120
5-bromo-1-[(2R,4S,5S)-5-(1-chloroprop-2-enyl)-4-fluorooxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 68501120) has the molecular formula C11H11BrClFN2O3 and a molecular weight of 353.58 g/mol. Its IUPAC name is 5-bromo-1-[(2R,4S,5S)-5-(1-chloroprop-2-enyl)-4-fluorooxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[(2R,4S,5S)-5-(1-chloroprop-2-enyl)-4-fluorooxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 68501120 |
| Molecular Formula | C11H11BrClFN2O3 |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 5-bromo-1-[(2R,4S,5S)-5-(1-chloroprop-2-enyl)-4-fluorooxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CC(Cl)[C@H]1O[C@@H](n2cc(Br)c(=O)[nH]c2=O)C[C@@H]1F |
| InChI | InChI=1S/C11H11BrClFN2O3/c1-2-6(13)9-7(14)3-8(19-9)16-4-5(12)10(17)15-11(16)18/h2,4,6-9H,1,3H2,(H,15,17,18)/t6?,7-,8+,9+/m0/s1 |
| InChIKey | AVILTRILTDMGNF-GSLILNRNSA-N |
| XLogP | 1.72 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|