C9H10ClFN2O4 — CID 54367159
1-[(2R,4S,5S)-5-[(S)-chloro(hydroxy)methyl]-4-fluorooxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 54367159) has the molecular formula C9H10ClFN2O4 and a molecular weight of 264.64 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-5-[(S)-chloro(hydroxy)methyl]-4-fluorooxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-5-[(S)-chloro(hydroxy)methyl]-4-fluorooxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54367159 |
| Molecular Formula | C9H10ClFN2O4 |
| Molecular Weight | 264.64 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 1-[(2R,4S,5S)-5-[(S)-chloro(hydroxy)methyl]-4-fluorooxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@H]2C[C@H](F)[C@@H]([C@@H](O)Cl)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H10ClFN2O4/c10-8(15)7-4(11)3-6(17-7)13-2-1-5(14)12-9(13)16/h1-2,4,6-8,15H,3H2,(H,12,14,16)/t4-,6+,7-,8+/m0/s1 |
| InChIKey | UQOYCSGXXQXTSL-VXUIKNBNSA-N |
| XLogP | -0.28 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.64 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|