C9H11BrN2O4S — CID 89322221
5-bromo-1-[(2R,5R)-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 89322221) has the molecular formula C9H11BrN2O4S and a molecular weight of 323.17 g/mol. Its IUPAC name is 5-bromo-1-[(2R,5R)-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[(2R,5R)-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89322221 |
| Molecular Formula | C9H11BrN2O4S |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 5-bromo-1-[(2R,5R)-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2CC(S)[C@@H](CO)O2)cc1Br |
| InChI | InChI=1S/C9H11BrN2O4S/c10-4-2-12(9(15)11-8(4)14)7-1-6(17)5(3-13)16-7/h2,5-7,13,17H,1,3H2,(H,11,14,15)/t5-,6?,7-/m1/s1 |
| InChIKey | UPXOZBSBUUWNED-YFBHCESUSA-N |
| XLogP | -0.12 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|