C11H14BrN2O9P — CID 21149031
[2-[5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-2-oxoethyl]phosphonic acid (PubChem CID 21149031) has the molecular formula C11H14BrN2O9P and a molecular weight of 429.12 g/mol. Its IUPAC name is [2-[5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 21149031 |
| Molecular Formula | C11H14BrN2O9P |
| Molecular Weight | 429.12 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | [2-[5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-2-oxoethyl]phosphonic acid |
| SMILES | O=C(CP(=O)(O)O)OC1CC(n2cc(Br)c(=O)[nH]c2=O)OC1CO |
| InChI | InChI=1S/C11H14BrN2O9P/c12-5-2-14(11(18)13-10(5)17)8-1-6(7(3-15)22-8)23-9(16)4-24(19,20)21/h2,6-8,15H,1,3-4H2,(H,13,17,18)(H2,19,20,21) |
| InChIKey | UHCRRTILRFWBCQ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.12 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|