C14H19N5O6 — CID 101494775
[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 4-azidobutanoate (PubChem CID 101494775) has the molecular formula C14H19N5O6 and a molecular weight of 353.34 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 4-azidobutanoate.
| Compound Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 4-azidobutanoate |
|---|---|
| PubChem CID | 101494775 |
| Molecular Formula | C14H19N5O6 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 4-azidobutanoate |
| SMILES | Cc1cn([C@H]2C[C@H](OC(=O)CCCN=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H19N5O6/c1-8-6-19(14(23)17-13(8)22)11-5-9(10(7-20)24-11)25-12(21)3-2-4-16-18-15/h6,9-11,20H,2-5,7H2,1H3,(H,17,22,23)/t9-,10+,11+/m0/s1 |
| InChIKey | YEYFWVMZBGOAIF-HBNTYKKESA-N |
| XLogP | 0.13 |
| TPSA | 159.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|