C15H23BrN4O6 — CID 14775355
[(2R,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-[2-(ethylamino)ethylamino]acetate (PubChem CID 14775355) has the molecular formula C15H23BrN4O6 and a molecular weight of 435.28 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-[2-(ethylamino)ethylamino]acetate.
| Compound Name | [(2R,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-[2-(ethylamino)ethylamino]acetate |
|---|---|
| PubChem CID | 14775355 |
| Molecular Formula | C15H23BrN4O6 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | [(2R,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-[2-(ethylamino)ethylamino]acetate |
| SMILES | CCNCCNCC(=O)O[C@H]1C[C@H](n2cc(Br)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C15H23BrN4O6/c1-2-17-3-4-18-6-13(22)26-10-5-12(25-11(10)8-21)20-7-9(16)14(23)19-15(20)24/h7,10-12,17-18,21H,2-6,8H2,1H3,(H,19,23,24)/t10-,11+,12+/m0/s1 |
| InChIKey | XVKPIWWEZDTNRI-QJPTWQEYSA-N |
| XLogP | -1.31 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|