C11H12BrIN2O4 — CID 68504258
5-bromo-1-[(2R,4S,5S)-4-hydroxy-5-(1-iodoprop-2-enyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 68504258) has the molecular formula C11H12BrIN2O4 and a molecular weight of 443.04 g/mol. Its IUPAC name is 5-bromo-1-[(2R,4S,5S)-4-hydroxy-5-(1-iodoprop-2-enyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[(2R,4S,5S)-4-hydroxy-5-(1-iodoprop-2-enyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 68504258 |
| Molecular Formula | C11H12BrIN2O4 |
| Molecular Weight | 443.04 g/mol |
| Exact Mass | 441.90 |
| IUPAC Name | 5-bromo-1-[(2R,4S,5S)-4-hydroxy-5-(1-iodoprop-2-enyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CC(I)[C@H]1O[C@@H](n2cc(Br)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C11H12BrIN2O4/c1-2-6(13)9-7(16)3-8(19-9)15-4-5(12)10(17)14-11(15)18/h2,4,6-9,16H,1,3H2,(H,14,17,18)/t6?,7-,8+,9+/m0/s1 |
| InChIKey | ICHIVQRCYFBJRE-GSLILNRNSA-N |
| XLogP | 0.94 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.04 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|