C9H14BrN3O7P+ — CID 90663807
1-[(4aR,6R,7aS)-2,2-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-5-bromopyrimidine-2,4-dione;azane (PubChem CID 90663807) has the molecular formula C9H14BrN3O7P+ and a molecular weight of 387.10 g/mol. Its IUPAC name is 1-[(4aR,6R,7aS)-2,2-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-5-bromopyrimidine-2,4-dione;azane.
| Compound Name | 1-[(4aR,6R,7aS)-2,2-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-5-bromopyrimidine-2,4-dione;azane |
|---|---|
| PubChem CID | 90663807 |
| Molecular Formula | C9H14BrN3O7P+ |
| Molecular Weight | 387.10 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | 1-[(4aR,6R,7aS)-2,2-dihydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-5-bromopyrimidine-2,4-dione;azane |
| SMILES | N.O=c1[nH]c(=O)n([C@H]2C[C@@H]3O[P+](O)(O)OC[C@H]3O2)cc1Br |
| InChI | InChI=1S/C9H10BrN2O7P.H3N/c10-4-2-12(9(14)11-8(4)13)7-1-5-6(18-7)3-17-20(15,16)19-5;/h2,5-7,15-16H,1,3H2;1H3/p+1/t5-,6+,7+;/m0./s1 |
| InChIKey | SOJPCDXLRPBETC-VWZUFWLJSA-O |
| XLogP | -0.17 |
| TPSA | 158.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.10 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|