C16H23FN2O7P+ — CID 139330564
1-[(4aR,6R,7aS)-2-(cyclohexylmethoxy)-2-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 139330564) has the molecular formula C16H23FN2O7P+ and a molecular weight of 405.34 g/mol. Its IUPAC name is 1-[(4aR,6R,7aS)-2-(cyclohexylmethoxy)-2-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7aS)-2-(cyclohexylmethoxy)-2-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139330564 |
| Molecular Formula | C16H23FN2O7P+ |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-[(4aR,6R,7aS)-2-(cyclohexylmethoxy)-2-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@@H]3O[P+](O)(OCC4CCCCC4)OC[C@H]3O2)cc1F |
| InChI | InChI=1S/C16H22FN2O7P/c17-11-7-19(16(21)18-15(11)20)14-6-12-13(25-14)9-24-27(22,26-12)23-8-10-4-2-1-3-5-10/h7,10,12-14,22H,1-6,8-9H2/p+1/t12-,13+,14+,27?/m0/s1 |
| InChIKey | RWCKSGMUDXFUIV-KCSNQXNZSA-O |
| XLogP | 1.65 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|