C16H24N2O6 — CID 90785140
5-ethenyl-1-[4-methoxy-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;prop-2-en-1-ol (PubChem CID 90785140) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-ethenyl-1-[4-methoxy-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;prop-2-en-1-ol.
| Compound Name | 5-ethenyl-1-[4-methoxy-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;prop-2-en-1-ol |
|---|---|
| PubChem CID | 90785140 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 5-ethenyl-1-[4-methoxy-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;prop-2-en-1-ol |
| SMILES | C=CCO.C=Cc1cn(C2CC(OC)C(COC)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H18N2O5.C3H6O/c1-4-8-6-15(13(17)14-12(8)16)11-5-9(19-3)10(20-11)7-18-2;1-2-3-4/h4,6,9-11H,1,5,7H2,2-3H3,(H,14,16,17);2,4H,1,3H2 |
| InChIKey | GMYFCEMANMBYSU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|