C20H32N4O6 — CID 140963987
(E)-N-(6-aminohexyl)-3-[1-[(2R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enamide (PubChem CID 140963987) has the molecular formula C20H32N4O6 and a molecular weight of 424.50 g/mol. Its IUPAC name is (E)-N-(6-aminohexyl)-3-[1-[(2R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enamide.
| Compound Name | (E)-N-(6-aminohexyl)-3-[1-[(2R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 140963987 |
| Molecular Formula | C20H32N4O6 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (E)-N-(6-aminohexyl)-3-[1-[(2R,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enamide |
| SMILES | COC[C@H]1O[C@@H](n2cc(/C=C/C(=O)NCCCCCCN)c(=O)[nH]c2=O)CC1OC |
| InChI | InChI=1S/C20H32N4O6/c1-28-13-16-15(29-2)11-18(30-16)24-12-14(19(26)23-20(24)27)7-8-17(25)22-10-6-4-3-5-9-21/h7-8,12,15-16,18H,3-6,9-11,13,21H2,1-2H3,(H,22,25)(H,23,26,27)/b8-7+/t15?,16-,18-/m1/s1 |
| InChIKey | XIVIMRFTLOMFOX-KZEYQZDMSA-N |
| XLogP | 0.13 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|