C27H41N6O11PS — CID 90963199
[5-[2,4-dioxo-5-[3-oxo-3-[6-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]hexylamino]prop-1-enyl]pyrimidin-1-yl]-3-methoxyoxolan-2-yl]methyl methyl hydrogen phosphate (PubChem CID 90963199) has the molecular formula C27H41N6O11PS and a molecular weight of 688.70 g/mol. Its IUPAC name is [5-[2,4-dioxo-5-[3-oxo-3-[6-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]hexylamino]prop-1-enyl]pyrimidin-1-yl]-3-methoxyoxolan-2-yl]methyl methyl hydrogen phosphate.
| Compound Name | [5-[2,4-dioxo-5-[3-oxo-3-[6-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]hexylamino]prop-1-enyl]pyrimidin-1-yl]-3-methoxyoxolan-2-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 90963199 |
| Molecular Formula | C27H41N6O11PS |
| Molecular Weight | 688.70 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | [5-[2,4-dioxo-5-[3-oxo-3-[6-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]hexylamino]prop-1-enyl]pyrimidin-1-yl]-3-methoxyoxolan-2-yl]methyl methyl hydrogen phosphate |
| SMILES | COC1CC(n2cc(C=CC(=O)NCCCCCCNC(=O)CC3SCC4NC(=O)NC43)c(=O)[nH]c2=O)OC1COP(=O)(O)OC |
| InChI | InChI=1S/C27H41N6O11PS/c1-41-18-11-23(44-19(18)14-43-45(39,40)42-2)33-13-16(25(36)32-27(33)38)7-8-21(34)28-9-5-3-4-6-10-29-22(35)12-20-24-17(15-46-20)30-26(37)31-24/h7-8,13,17-20,23-24H,3-6,9-12,14-15H2,1-2H3,(H,28,34)(H,29,35)(H,39,40)(H2,30,31,37)(H,32,36,38) |
| InChIKey | BBMWDCRUXMLBKZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 228.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.70 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|