C18H29N4O10P — CID 130245063
[(2R,3R)-5-[5-[(E)-3-(6-aminohexylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 130245063) has the molecular formula C18H29N4O10P and a molecular weight of 492.42 g/mol. Its IUPAC name is [(2R,3R)-5-[5-[(E)-3-(6-aminohexylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R)-5-[5-[(E)-3-(6-aminohexylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 130245063 |
| Molecular Formula | C18H29N4O10P |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [(2R,3R)-5-[5-[(E)-3-(6-aminohexylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NCCCCCCNC(=O)/C=C/c1cn(C2O[C@H](COP(=O)(O)O)[C@H](O)C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H29N4O10P/c19-7-3-1-2-4-8-20-13(23)6-5-11-9-22(18(27)21-16(11)26)17-15(25)14(24)12(32-17)10-31-33(28,29)30/h5-6,9,12,14-15,17,24-25H,1-4,7-8,10,19H2,(H,20,23)(H,21,26,27)(H2,28,29,30)/b6-5+/t12-,14+,15?,17?/m1/s1 |
| InChIKey | NAFSKORIFBBADR-XKNCOUSHSA-N |
| XLogP | -2.09 |
| TPSA | 226.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|