C23H32N9O9P — CID 144836974
[5-[5-[(E)-3-[2-[[9-(4-aminobutyl)purin-6-yl]amino]ethylamino]-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 144836974) has the molecular formula C23H32N9O9P and a molecular weight of 609.54 g/mol. Its IUPAC name is [5-[5-[(E)-3-[2-[[9-(4-aminobutyl)purin-6-yl]amino]ethylamino]-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [5-[5-[(E)-3-[2-[[9-(4-aminobutyl)purin-6-yl]amino]ethylamino]-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 144836974 |
| Molecular Formula | C23H32N9O9P |
| Molecular Weight | 609.54 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | [5-[5-[(E)-3-[2-[[9-(4-aminobutyl)purin-6-yl]amino]ethylamino]-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NCCCCn1cnc2c(NCCNC(=O)/C=C/c3cn(C4CC(O)C(COP(=O)(O)O)O4)c(=O)[nH]c3=O)ncnc21 |
| InChI | InChI=1S/C23H32N9O9P/c24-5-1-2-8-31-13-29-19-20(27-12-28-21(19)31)26-7-6-25-17(34)4-3-14-10-32(23(36)30-22(14)35)18-9-15(33)16(41-18)11-40-42(37,38)39/h3-4,10,12-13,15-16,18,33H,1-2,5-9,11,24H2,(H,25,34)(H,26,27,28)(H,30,35,36)(H2,37,38,39)/b4-3+ |
| InChIKey | ZJZSMODDWFVUJY-ONEGZZNKSA-N |
| XLogP | -1.59 |
| TPSA | 261.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.54 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|