C26H38N9O9P — CID 140748545
[5-[2,4-dioxo-5-[(E)-3-oxo-3-[2-[[9-[4-(trimethylazaniumyl)butyl]purin-6-yl]amino]ethylamino]prop-1-enyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 140748545) has the molecular formula C26H38N9O9P and a molecular weight of 651.62 g/mol. Its IUPAC name is [5-[2,4-dioxo-5-[(E)-3-oxo-3-[2-[[9-[4-(trimethylazaniumyl)butyl]purin-6-yl]amino]ethylamino]prop-1-enyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [5-[2,4-dioxo-5-[(E)-3-oxo-3-[2-[[9-[4-(trimethylazaniumyl)butyl]purin-6-yl]amino]ethylamino]prop-1-enyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 140748545 |
| Molecular Formula | C26H38N9O9P |
| Molecular Weight | 651.62 g/mol |
| Exact Mass | 651.25 |
| IUPAC Name | [5-[2,4-dioxo-5-[(E)-3-oxo-3-[2-[[9-[4-(trimethylazaniumyl)butyl]purin-6-yl]amino]ethylamino]prop-1-enyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | C[N+](C)(C)CCCCn1cnc2c(NCCNC(=O)/C=C/c3cn(C4CC(O)C(COP(=O)([O-])O)O4)c(=O)[nH]c3=O)ncnc21 |
| InChI | InChI=1S/C26H38N9O9P/c1-35(2,3)11-5-4-10-33-16-31-22-23(29-15-30-24(22)33)28-9-8-27-20(37)7-6-17-13-34(26(39)32-25(17)38)21-12-18(36)19(44-21)14-43-45(40,41)42/h6-7,13,15-16,18-19,21,36H,4-5,8-12,14H2,1-3H3,(H4-,27,28,29,30,32,37,38,39,40,41,42)/b7-6+ |
| InChIKey | NJZKMYWWCALVND-VOTSOKGWSA-N |
| XLogP | -1.47 |
| TPSA | 238.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.62 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|